ChemNet > CAS > 300541-91-7 4-morpholino-3-nitrobenzaldehyde
300541-91-7 4-morpholino-3-nitrobenzaldehyde
| Nama produk |
4-morpholino-3-nitrobenzaldehyde |
| Sinonim |
4-morpholin-4-yl-3-nitrobenzaldehyde |
| MF |
C11H12N2O4 |
| Berat Molekul |
236.224 |
| InChI |
InChI=1/C11H12N2O4/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12/h1-2,7-8H,3-6H2 |
| CAS NO |
300541-91-7 |
| Struktur Molekul |
|
| Kepadatan |
1.34g/cm3 |
| Titik lebur |
53℃ |
| Titik didih |
431.6°C at 760 mmHg |
| Indeks bias |
1.613 |
| Titik nyala |
214.8°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
