ChemNet > CAS > 3096-52-4 2-nitro-9-fluorenone
3096-52-4 2-nitro-9-fluorenone
Nama produk |
2-nitro-9-fluorenone |
Sinonim |
2-Nitro-9-fluorenone; 4-07-00-01636 (Beilstein Handbook Reference); BRN 2052959; CCRIS 2540; NSC 12365; 9H-Fluoren-9-one, 2-nitro-; 2-nitro-9H-fluoren-9-one |
MF |
C13H7NO3 |
Berat Molekul |
225.1996 |
InChI |
InChI=1/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
CAS NO |
3096-52-4 |
Struktur Molekul |
|
Kepadatan |
1.437g/cm3 |
Titik lebur |
222-223℃ |
Titik didih |
419°C at 760 mmHg |
Indeks bias |
1.698 |
Titik nyala |
215.1°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|