ChemNet > CAS > 312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
Nama produk |
4-(Trifluoromethylsulfonyl)benzonitrile |
Sinonim |
4-Cyanophenyl trifluoromethyl sulphone; 4-(Trifluoromethylsulphonyl)benzonitrile; 4-(Trifluoromethanesulfonyl)benzonitrile |
MF |
C6H4FNO |
Berat Molekul |
125.1005 |
InChI |
InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
CAS NO |
312-21-0 |
Struktur Molekul |
|
Kepadatan |
1.269g/cm3 |
Titik lebur |
84-88℃ |
Titik didih |
166.5°C at 760 mmHg |
Indeks bias |
1.543 |
Titik nyala |
54.5°C |
Cinta bahaya |
|
Kod Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|