ChemNet > CAS > 3141-25-1 2,3,4-Tribromothiophene
3141-25-1 2,3,4-Tribromothiophene
Nama produk |
2,3,4-Tribromothiophene |
MF |
C4HBr3S |
Berat Molekul |
320.8277 |
InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
CAS NO |
3141-25-1 |
EINECS |
221-545-2 |
Struktur Molekul |
|
Kepadatan |
2.516g/cm3 |
Titik didih |
277.5°C at 760 mmHg |
Indeks bias |
1.671 |
Titik nyala |
121.6°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|