ChemNet > CAS > 3259-03-8 2-(2-Ethoxyphenoxy)ethyl bromide
3259-03-8 2-(2-Ethoxyphenoxy)ethyl bromide
| Nama produk |
2-(2-Ethoxyphenoxy)ethyl bromide |
| Sinonim |
2-(2-ethoxyphenoxy)bromide ethane; 5-(2-oxypropyl)-2-methoxybenzene sulphonamide; 1-(2-bromoethoxy)-2-ethoxybenzene; 2-(2-ethoxyphenoxy) bromide ethane |
| MF |
C10H13BrO2 |
| Berat Molekul |
245.113 |
| InChI |
InChI=1/C10H13BrO2/c1-2-12-9-5-3-4-6-10(9)13-8-7-11/h3-6H,2,7-8H2,1H3 |
| CAS NO |
3259-03-8 |
| Struktur Molekul |
|
| Kepadatan |
1.334g/cm3 |
| Titik didih |
286.9°C at 760 mmHg |
| Indeks bias |
1.528 |
| Titik nyala |
119.2°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
