ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
Nama produk |
3-fluoro-4-methoxybenzonitrile |
Sinonim |
Fluoromethoxybenzonitrile |
MF |
C8H6FNO |
Berat Molekul |
151.1377 |
InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS NO |
331-62-4 |
Struktur Molekul |
|
Kepadatan |
1.18g/cm3 |
Titik didih |
254.3°C at 760 mmHg |
Indeks bias |
1.505 |
Titik nyala |
107.6°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|