ChemNet > CAS > 3319-01-5 1-Cyclohexylpiperidine
3319-01-5 1-Cyclohexylpiperidine
Nama produk |
1-Cyclohexylpiperidine |
Sinonim |
1-Piperidinocyclohexane; N-cyclohexylpiperidine |
MF |
C11H21N |
Berat Molekul |
167.2911 |
InChI |
InChI=1/C11H21N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11H,1-10H2 |
CAS NO |
3319-01-5 |
EINECS |
222-016-9 |
Struktur Molekul |
|
Kepadatan |
0.941g/cm3 |
Titik didih |
234.3°C at 760 mmHg |
Indeks bias |
1.501 |
Titik nyala |
101.4°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|