ChemNet > CAS > 33775-94-9 2-Iodothioanisole
33775-94-9 2-Iodothioanisole
Nama produk |
2-Iodothioanisole |
Sinonim |
2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
MF |
C7H7IS |
Berat Molekul |
250.0999 |
InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
CAS NO |
33775-94-9 |
Struktur Molekul |
|
Kepadatan |
1.78g/cm3 |
Titik didih |
253°C at 760 mmHg |
Indeks bias |
1.67 |
Titik nyala |
106.8°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|