ChemNet > CAS > 3512-13-8 2,3,4,6-Tetrafluoropyridine
3512-13-8 2,3,4,6-Tetrafluoropyridine
Nama produk |
2,3,4,6-Tetrafluoropyridine |
MF |
C5HF4N |
Berat Molekul |
151.0618 |
InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
CAS NO |
3512-13-8 |
Struktur Molekul |
|
Kepadatan |
1.518g/cm3 |
Titik didih |
114.6°C at 760 mmHg |
Indeks bias |
1.403 |
Titik nyala |
23.1°C |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|