ChemNet > CAS > 359-37-5 iodotrifluoroethylene
359-37-5 iodotrifluoroethylene
Nama produk |
iodotrifluoroethylene |
Sinonim |
Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
MF |
C2F3I |
Berat Molekul |
207.9211 |
InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
CAS NO |
359-37-5 |
EINECS |
206-629-9 |
Struktur Molekul |
|
Kepadatan |
2.311g/cm3 |
Titik didih |
30°C at 760 mmHg |
Indeks bias |
1.457 |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|