ChemNet > CAS > 3612-16-6 1-Ethyl-3-methyl-4-piperidone
3612-16-6 1-Ethyl-3-methyl-4-piperidone
Nama produk |
1-Ethyl-3-methyl-4-piperidone |
Sinonim |
1-ethyl-3-methylpiperidin-4-one |
MF |
C8H15NO |
Berat Molekul |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
CAS NO |
3612-16-6 |
Struktur Molekul |
|
Kepadatan |
0.931g/cm3 |
Titik didih |
212.3°C at 760 mmHg |
Indeks bias |
1.45 |
Titik nyala |
76.2°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|