ChemNet > CAS > 3622-04-6 1,3-Benzothiazole-2-carboxylic acid
3622-04-6 1,3-Benzothiazole-2-carboxylic acid
Nama produk |
1,3-Benzothiazole-2-carboxylic acid |
Sinonim |
benzo[d]thiazole-2-carboxylic acid |
MF |
C8H5NO2S |
Berat Molekul |
179.1958 |
InChI |
InChI=1/C8H5NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4H,(H,10,11) |
CAS NO |
3622-04-6 |
Struktur Molekul |
|
Kepadatan |
1.508g/cm3 |
Titik lebur |
148℃ |
Titik didih |
378.5°C at 760 mmHg |
Indeks bias |
1.731 |
Titik nyala |
182.7°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|