ChemNet > CAS > 3681-71-8 cis-3-hexenyl acetate
3681-71-8 cis-3-hexenyl acetate
| Nama produk |
cis-3-hexenyl acetate |
| Sinonim |
Cis-3-Hexene-1-Yl Acetate; 3-Hexen-1-ol, acetate, (Z)-; ACETATO DE CIS-3-HEXENILO; Leaf acetate; Verdural extra; (Z)-3-hexenyl acetate |
| MF |
C8H14O2 |
| Berat Molekul |
142.2 |
| InChI |
InChI=1/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
| CAS NO |
3681-71-8 |
| EINECS |
222-960-1 |
| Struktur Molekul |
|
| Kepadatan |
0.897 |
| Titik didih |
75-76℃ (23 mmHg) |
| Indeks bias |
1.427 |
| Titik nyala |
135�H |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
