ChemNet > CAS > 37593-06-9 1-(4-decylphenyl)ethan-1-one
37593-06-9 1-(4-decylphenyl)ethan-1-one
Nama produk |
1-(4-decylphenyl)ethan-1-one |
Sinonim |
1-(4-decylphenyl)ethanone |
MF |
C18H28O |
Berat Molekul |
260.4143 |
InChI |
InChI=1/C18H28O/c1-3-4-5-6-7-8-9-10-11-17-12-14-18(15-13-17)16(2)19/h12-15H,3-11H2,1-2H3 |
CAS NO |
37593-06-9 |
Struktur Molekul |
|
Kepadatan |
0.911g/cm3 |
Titik lebur |
33℃ |
Titik didih |
371.4°C at 760 mmHg |
Indeks bias |
1.491 |
Titik nyala |
156.6°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|