ChemNet > CAS > 40003-41-6 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid
40003-41-6 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid
Nama produk |
2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid |
Sinonim |
2-bromo-4-methylthiazole-5-carboxylic acid |
MF |
C5H4BrNO2S |
Berat Molekul |
222.0598 |
InChI |
InChI=1/C5H4BrNO2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H,8,9) |
CAS NO |
40003-41-6 |
Struktur Molekul |
|
Kepadatan |
1.895g/cm3 |
Titik lebur |
153℃ |
Titik didih |
349.5°C at 760 mmHg |
Indeks bias |
1.639 |
Titik nyala |
165.2°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|