ChemNet > CAS > 4016-63-1 8-bromoguanosine
4016-63-1 8-bromoguanosine
Nama produk |
8-bromoguanosine |
Sinonim |
8-Bromoguanosine hydrate; 2-amino-8-bromo-9-pentofuranosyl-3,9-dihydro-6H-purin-6-one; 2-amino-8-bromo-9-beta-D-glycero-pentofuranosyl-5,9-dihydro-6H-purin-6-one; 8-Bromo-Guanosine; 8-Bromo Guanosine |
MF |
C10H12BrN5O5 |
Berat Molekul |
362.1368 |
InChI |
InChI=1/C10H12BrN5O5/c11-9-13-3-6(14-10(12)15-7(3)20)16(9)8-5(19)4(18)2(1-17)21-8/h2-5,8,17-19H,1H2,(H2,12,15,20)/t2-,3?,4?,5?,8-/m1/s1 |
CAS NO |
4016-63-1 |
EINECS |
223-677-6 |
Struktur Molekul |
|
Kepadatan |
2.62g/cm3 |
Titik didih |
611.1°C at 760 mmHg |
Indeks bias |
1.986 |
Titik nyala |
323.4°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|