ChemNet > CAS > 40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
Nama produk |
3,4-Dibromo-2,5-dichlorothiophene |
MF |
C4Br2Cl2S |
Berat Molekul |
310.8218 |
InChI |
InChI=1/C4Br2Cl2S/c5-1-2(6)4(8)9-3(1)7 |
CAS NO |
40477-45-0 |
Struktur Molekul |
|
Kepadatan |
2.299g/cm3 |
Titik didih |
284.1°C at 760 mmHg |
Indeks bias |
1.658 |
Titik nyala |
125.6°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|