ChemNet > CAS > 437-17-2 Triphenylcarbenium hexafluorophosphate
437-17-2 Triphenylcarbenium hexafluorophosphate
| Nama produk |
Triphenylcarbenium hexafluorophosphate |
| Sinonim |
Trityl hexafluorophosphate; Tritylium hexafluorophosphate; triphenylmethylium hexafluorophosphate |
| Berat Molekul |
243.3219 |
| InChI |
InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| CAS NO |
437-17-2 |
| EINECS |
207-112-0 |
| Struktur Molekul |
|
| Titik lebur |
150℃ |
| Cinta bahaya |
 C:Corrosive;
|
| Kod Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
R34:Causes burns.;
|
| Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
|
|
