ChemNet > CAS > 455-84-5 4-Fluoro-3-methylbenzoyl chloride
455-84-5 4-Fluoro-3-methylbenzoyl chloride
| Nama produk |
4-Fluoro-3-methylbenzoyl chloride |
| Sinonim |
4-Fluoro-m-toluoyl chloride |
| MF |
C8H6ClFO |
| Berat Molekul |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
| CAS NO |
455-84-5 |
| Struktur Molekul |
|
| Kepadatan |
1.265g/cm3 |
| Titik didih |
214.1°C at 760 mmHg |
| Indeks bias |
1.518 |
| Titik nyala |
83.3°C |
| Cinta bahaya |
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
