ChemNet > CAS > 465514-33-4 (2-morpholinophenyl)methanol
465514-33-4 (2-morpholinophenyl)methanol
Nama produk |
(2-morpholinophenyl)methanol |
Sinonim |
(2-morpholin-4-ylphenyl)methanol |
MF |
C11H15NO2 |
Berat Molekul |
193.2423 |
InChI |
InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
CAS NO |
465514-33-4 |
Struktur Molekul |
|
Kepadatan |
1.16g/cm3 |
Titik lebur |
54℃ |
Titik didih |
362.8°C at 760 mmHg |
Indeks bias |
1.568 |
Titik nyala |
173.2°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|