ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
Nama produk |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
Sinonim |
5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
MF |
C11H15NO4S |
Berat Molekul |
257.3061 |
InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
CAS NO |
4815-30-9 |
EINECS |
225-388-0 |
Struktur Molekul |
|
Kepadatan |
1.247g/cm3 |
Titik lebur |
103-108℃ |
Titik didih |
372.6°C at 760 mmHg |
Indeks bias |
1.558 |
Titik nyala |
179.1°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|