ChemNet > CAS > 4964-71-0 5-Bromo-quinoline
4964-71-0 5-Bromo-quinoline
Nama produk |
5-Bromo-quinoline |
Sinonim |
5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
MF |
C9H6BrN |
Berat Molekul |
208.0546 |
InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
CAS NO |
4964-71-0 |
Struktur Molekul |
|
Kepadatan |
1.564g/cm3 |
Titik didih |
295.9°C at 760 mmHg |
Indeks bias |
1.673 |
Titik nyala |
132.8°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|