ChemNet > CAS > 50907-46-5 5-(2-Chlorophenyl)-1H-tetrazole
50907-46-5 5-(2-Chlorophenyl)-1H-tetrazole
Nama produk |
5-(2-Chlorophenyl)-1H-tetrazole |
Sinonim |
5-(2-chlorophenyl)-2H-tetrazole |
MF |
C7H5ClN4 |
Berat Molekul |
180.5944 |
InChI |
InChI=1/C7H5ClN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
CAS NO |
50907-46-5 |
Struktur Molekul |
|
Kepadatan |
1.448g/cm3 |
Titik didih |
367.5°C at 760 mmHg |
Indeks bias |
1.631 |
Titik nyala |
207.6°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|