ChemNet > CAS > 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
Nama produk |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
MF |
C10H7ClN4 |
Berat Molekul |
218.6424 |
InChI |
InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
CAS NO |
51516-67-7 |
Struktur Molekul |
|
Kepadatan |
1.41g/cm3 |
Titik lebur |
170℃ |
Titik didih |
424.2°C at 760 mmHg |
Indeks bias |
1.686 |
Titik nyala |
210.4°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|