ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
Nama produk |
Diphenylborinic acid 2-aminoethyl ester |
Sinonim |
2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
MF |
C14H16BNO |
Berat Molekul |
225.0939 |
InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
CAS NO |
524-95-8 |
EINECS |
208-366-5 |
Struktur Molekul |
|
Kepadatan |
1.04g/cm3 |
Titik lebur |
190-194℃ |
Titik didih |
325.3°C at 760 mmHg |
Indeks bias |
1.559 |
Titik nyala |
150.6°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|