ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
Nama produk |
thianaphthene-3-carboxaldehyde |
Sinonim |
1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
MF |
C9H6OS |
Berat Molekul |
162.2083 |
InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
CAS NO |
5381-20-4 |
Struktur Molekul |
|
Kepadatan |
1.3g/cm3 |
Titik lebur |
56-58℃ |
Titik didih |
303.2°C at 760 mmHg |
Indeks bias |
1.719 |
Titik nyala |
137.2°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|