ChemNet > CAS > 5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
| Nama produk |
ethyl 4-amino-3,5-diiodobenzoate |
| MF |
C9H9I2NO2 |
| Berat Molekul |
416.9822 |
| InChI |
InChI=1/C9H9I2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
| CAS NO |
5400-81-7 |
| Struktur Molekul |
|
| Kepadatan |
2.191g/cm3 |
| Titik lebur |
148℃ |
| Titik didih |
449.1°C at 760 mmHg |
| Indeks bias |
1.689 |
| Titik nyala |
225.4°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
