ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
| Nama produk |
p-Diethylaminoacetophenone |
| Sinonim |
4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
| MF |
C12H17NO |
| Berat Molekul |
191.2695 |
| InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
| CAS NO |
5520-66-1 |
| Struktur Molekul |
|
| Kepadatan |
0.996g/cm3 |
| Titik didih |
313.9°C at 760 mmHg |
| Indeks bias |
1.536 |
| Titik nyala |
114.4°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
