ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
Nama produk |
p-Diethylaminoacetophenone |
Sinonim |
4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
MF |
C12H17NO |
Berat Molekul |
191.2695 |
InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
CAS NO |
5520-66-1 |
Struktur Molekul |
|
Kepadatan |
0.996g/cm3 |
Titik didih |
313.9°C at 760 mmHg |
Indeks bias |
1.536 |
Titik nyala |
114.4°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|