ChemNet > CAS > 5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
Nama produk |
D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1) |
Sinonim |
Calcium borogluconate; AI3-52160; D-Gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1); calcium bis{2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoic acid |
MF |
C6H11BO8 |
Berat Molekul |
221.9577 |
InChI |
InChI=1/C6H11BO8/c8-1-2-5(15-7(13)14-2)3(9)4(10)6(11)12/h2-5,8-10,13H,1H2,(H,11,12) |
CAS NO |
5743-34-0 |
EINECS |
227-264-1 |
Struktur Molekul |
|
Kepadatan |
1.68g/cm3 |
Titik didih |
530.9°C at 760 mmHg |
Indeks bias |
1.558 |
Titik nyala |
274.9°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|