ChemNet > CAS > 59-82-5 5-Nitro-2-furonitrile
59-82-5 5-Nitro-2-furonitrile
Nama produk |
5-Nitro-2-furonitrile |
Sinonim |
5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
MF |
C5H2N2O3 |
Berat Molekul |
138.081 |
InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS NO |
59-82-5 |
Struktur Molekul |
|
Kepadatan |
1.46g/cm3 |
Titik didih |
234.7°C at 760 mmHg |
Indeks bias |
1.544 |
Titik nyala |
95.7°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|