ChemNet > CAS > 591-08-2 N-Acetylthiourea
591-08-2 N-Acetylthiourea
| Nama produk |
N-Acetylthiourea |
| Sinonim |
N-Acetylthiourea,98%; N-carbamothioylacetamide |
| MF |
C3H6N2OS |
| Berat Molekul |
118.1575 |
| InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
| CAS NO |
591-08-2 |
| EINECS |
209-699-9 |
| Struktur Molekul |
|
| Kepadatan |
1.275g/cm3 |
| Titik lebur |
166-168℃ |
| Titik didih |
208.6°C at 760 mmHg |
| Indeks bias |
1.569 |
| Titik nyala |
80°C |
| Cinta bahaya |
 T:Toxic;
|
| Kod Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
