ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
Nama produk |
3-Hydroxy-2-nitrobenzoic acid |
MF |
C7H5NO5 |
Berat Molekul |
183.1183 |
InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
CAS NO |
602-00-6 |
Struktur Molekul |
|
Kepadatan |
1.631g/cm3 |
Titik didih |
362.9°C at 760 mmHg |
Indeks bias |
1.663 |
Titik nyala |
166.7°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|