ChemNet > CAS > 627-09-8 Propargylacetate(Aceticacidpropargylester)
627-09-8 Propargylacetate(Aceticacidpropargylester)
Nama produk |
Propargylacetate(Aceticacidpropargylester) |
Sinonim |
Propargyl acetate (Acetic acid propargyl ester); Propargyl acetate; Acetic acid propargyl ester~2-Propyn-1-yl acetate; prop-2-ynyl acetate |
MF |
C5H6O2 |
Berat Molekul |
98.0999 |
InChI |
InChI=1/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 |
CAS NO |
627-09-8 |
Struktur Molekul |
|
Kepadatan |
0.997g/cm3 |
Titik didih |
122.4°C at 760 mmHg |
Indeks bias |
1.418 |
Titik nyala |
28.3°C |
Cinta bahaya |
|
Kod Risiko |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|