ChemNet > CAS > 63135-03-5 Ethyl-6-(2-oxocyclopentyl)hexanoate
63135-03-5 Ethyl-6-(2-oxocyclopentyl)hexanoate
Nama produk |
Ethyl-6-(2-oxocyclopentyl)hexanoate |
Sinonim |
ethyl 6-(2-oxocyclopentyl)hexanoate; ethyl 6-[(1S)-2-oxocyclopentyl]hexanoate; ethyl 6-[(1R)-2-oxocyclopentyl]hexanoate |
MF |
C13H22O3 |
Berat Molekul |
226.312 |
InChI |
InChI=1/C13H22O3/c1-2-16-13(15)10-5-3-4-7-11-8-6-9-12(11)14/h11H,2-10H2,1H3/t11-/m1/s1 |
CAS NO |
63135-03-5 |
Struktur Molekul |
|
Kepadatan |
1.004g/cm3 |
Titik didih |
314.2°C at 760 mmHg |
Indeks bias |
1.463 |
Titik nyala |
134.3°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|