CAS No: 63689-59-8, Chemical Name: 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione
the physical and chemical property of 63689-59-8, 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione is provided by ChemNet.com
ChemNet > CAS > 63689-59-8 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione
63689-59-8 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione
Nama produk |
1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione |
Sinonim |
|
MF |
C12H20O7S |
Berat Molekul |
308.348 |
InChI |
InChI=1/C12H20O7S/c13-11-9-17-10-12(14)19-4-2-16-6-8-20-7-5-15-1-3-18-11/h1-10H2 |
CAS NO |
63689-59-8 |
Struktur Molekul |
|
Kepadatan |
1.154g/cm3 |
Titik didih |
553.9°C at 760 mmHg |
Indeks bias |
1.45 |
Titik nyala |
294.5°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|