ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
| Nama produk |
2,6-Dimethylbenzonitrile |
| Sinonim |
2,6-Dimethylbenzoniitrile |
| MF |
C9H9N |
| Berat Molekul |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
| CAS NO |
6575-13-9 |
| EINECS |
229-503-5 |
| Struktur Molekul |
|
| Kepadatan |
0.99g/cm3 |
| Titik lebur |
87-89℃ |
| Titik didih |
228.7°C at 760 mmHg |
| Indeks bias |
1.525 |
| Titik nyala |
91.9°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
