ChemNet > CAS > 68301-77-9 2-amino-6-chloro-3-formylchromone
68301-77-9 2-amino-6-chloro-3-formylchromone
Nama produk |
2-amino-6-chloro-3-formylchromone |
MF |
C10H6ClNO3 |
Berat Molekul |
223.6125 |
InChI |
InChI=1/C10H6ClNO3/c11-5-1-2-8-6(3-5)9(14)7(4-13)10(12)15-8/h1-4H,12H2 |
CAS NO |
68301-77-9 |
Struktur Molekul |
|
Kepadatan |
1.606g/cm3 |
Titik lebur |
300℃ |
Titik didih |
447.3°C at 760 mmHg |
Indeks bias |
1.717 |
Titik nyala |
224.3°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|