ChemNet > CAS > 6833-15-4 4-chlorobenzanilide
6833-15-4 4-chlorobenzanilide
Nama produk |
4-chlorobenzanilide |
Sinonim |
4-chloro-N-phenylbenzamide |
MF |
C13H10ClNO |
Berat Molekul |
231.6776 |
InChI |
InChI=1/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
CAS NO |
6833-15-4 |
Struktur Molekul |
|
Kepadatan |
1.285g/cm3 |
Titik lebur |
199-201℃ |
Titik didih |
288.6°C at 760 mmHg |
Indeks bias |
1.649 |
Titik nyala |
128.3°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|