ChemNet > CAS > 69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
| Nama produk |
Ethyl 5-nitrobenzofuran-2-carboxylate |
| Sinonim |
5-Nitrobenzo[b]furan-2-carboxylic acid ethyl ester; 5-nitro-benzofuran-2-carboxylic acid ethyl ester; Vilazodone Intermediate 7; Ethyl 5-nitrobenzo[b]furan-2-carboxylate |
| MF |
C11H9NO5 |
| Berat Molekul |
235.1929 |
| InChI |
InChI=1/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
| CAS NO |
69604-00-8 |
| Struktur Molekul |
|
| Kepadatan |
1.362g/cm3 |
| Titik lebur |
150℃ |
| Titik didih |
359.7°C at 760 mmHg |
| Indeks bias |
1.603 |
| Titik nyala |
171.3°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
