ChemNet > CAS > 69614-95-5 4-(2-Chloroethyl)acetophenone
69614-95-5 4-(2-Chloroethyl)acetophenone
Nama produk |
4-(2-Chloroethyl)acetophenone |
Sinonim |
4'-(beta-Chloroethyl)acetophenone; 1-[4-(2-chloroethyl)phenyl]ethanone |
MF |
C10H11ClO |
Berat Molekul |
182.6467 |
InChI |
InChI=1/C10H11ClO/c1-8(12)10-4-2-9(3-5-10)6-7-11/h2-5H,6-7H2,1H3 |
CAS NO |
69614-95-5 |
Struktur Molekul |
|
Kepadatan |
1.105g/cm3 |
Titik didih |
297°C at 760 mmHg |
Indeks bias |
1.525 |
Titik nyala |
149.8°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|