ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
Nama produk |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
Sinonim |
Methyl 2,5-dimethylpyrrole-3-carboxylate |
MF |
C8H11NO2 |
Berat Molekul |
153.1784 |
InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
CAS NO |
69687-80-5 |
Struktur Molekul |
|
Kepadatan |
1.108g/cm3 |
Titik lebur |
115℃ |
Titik didih |
294.3°C at 760 mmHg |
Indeks bias |
1.521 |
Titik nyala |
131.8°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|