ChemNet > CAS > 7145-82-6 2,4,6-Trichloroiodobenzene
7145-82-6 2,4,6-Trichloroiodobenzene
| Nama produk |
2,4,6-Trichloroiodobenzene |
| Sinonim |
2,4,5-Trichloroiodobenzene; 1-Iodo-2,4,5-trichlorobenzene; 1,2,4-trichloro-5-iodobenzene |
| MF |
C6H2Cl3I |
| Berat Molekul |
307.3435 |
| InChI |
InChI=1/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| CAS NO |
7145-82-6 |
| Struktur Molekul |
|
| Kepadatan |
2.085g/cm3 |
| Titik lebur |
56-58℃ |
| Titik didih |
292.8°C at 760 mmHg |
| Indeks bias |
1.651 |
| Titik nyala |
130.9°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
