ChemNet > CAS > 7423-93-0 3-Chloro-L-tyrosine
7423-93-0 3-Chloro-L-tyrosine
Nama produk |
3-Chloro-L-tyrosine |
Sinonim |
3-Chloro-4-hydroxy-L-phenylalanine~H-Tyr(3-Cl)-OH; 3-chlorotyrosine; H-Tyr(3-Cl)-OH |
MF |
C9H10ClNO3 |
Berat Molekul |
215.6336 |
InChI |
InChI=1/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
CAS NO |
7423-93-0 |
EINECS |
231-050-3 |
Struktur Molekul |
|
Kepadatan |
1.458g/cm3 |
Titik lebur |
249℃ |
Titik didih |
388.6°C at 760 mmHg |
Indeks bias |
1.625 |
Titik nyala |
188.8°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|