CAS No: 76263-11-1, Chemical Name: ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate
the physical and chemical property of 76263-11-1, ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate is provided by ChemNet.com
ChemNet > CAS > 76263-11-1 ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate
76263-11-1 ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate
Nama produk |
ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate |
Sinonim |
4-Benzothiazolecarboxylic acid, 2-amino-4,5,6,7-tetrahydro-, ethyl ester; Ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate; ETHYL 2-AMINO-4,5,6,7-TETRAHYDROBENZOTHIAZOLE-4-CARBOXYLATE |
MF |
C10H14N2O2S |
Berat Molekul |
226.2954 |
InChI |
InChI=1/C10H14N2O2S/c1-2-14-9(13)6-4-3-5-7-8(6)12-10(11)15-7/h6H,2-5H2,1H3,(H2,11,12) |
CAS NO |
76263-11-1 |
Struktur Molekul |
|
Kepadatan |
1.29g/cm3 |
Titik didih |
381.014°C at 760 mmHg |
Indeks bias |
1.592 |
Titik nyala |
184.231°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|