ChemNet > CAS > 7650-84-2 diphenylpropylphosphine
7650-84-2 diphenylpropylphosphine
Nama produk |
diphenylpropylphosphine |
Sinonim |
Diphenyl-n-propylphosphine; n-Propyldiphenylphosphine; Diphenyln-propylphosphine; diphenyl(propyl)phosphane |
MF |
C15H17P |
Berat Molekul |
228.2692 |
InChI |
InChI=1/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
CAS NO |
7650-84-2 |
EINECS |
231-607-0 |
Struktur Molekul |
|
Titik didih |
304.1°C at 760 mmHg |
Titik nyala |
150.5°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|