ChemNet > CAS > 79636-94-5 5-Bromo-2-ethoxybenzaldehyde
79636-94-5 5-Bromo-2-ethoxybenzaldehyde
Nama produk |
5-Bromo-2-ethoxybenzaldehyde |
MF |
C9H9BrO2 |
Berat Molekul |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
CAS NO |
79636-94-5 |
Struktur Molekul |
|
Kepadatan |
1.451g/cm3 |
Titik lebur |
68℃ |
Titik didih |
302.7°C at 760 mmHg |
Indeks bias |
1.573 |
Titik nyala |
136.9°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|