ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
| Nama produk |
2,4-Dichlorophenethylalcohol |
| Sinonim |
2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
| MF |
C8H8Cl2O |
| Berat Molekul |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
| CAS NO |
81156-68-5 |
| Struktur Molekul |
|
| Kepadatan |
1.329g/cm3 |
| Titik didih |
276.6°C at 760 mmHg |
| Indeks bias |
1.569 |
| Titik nyala |
117.2°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
