ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
Nama produk |
2,4-Dichlorophenethylalcohol |
Sinonim |
2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
MF |
C8H8Cl2O |
Berat Molekul |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
CAS NO |
81156-68-5 |
Struktur Molekul |
|
Kepadatan |
1.329g/cm3 |
Titik didih |
276.6°C at 760 mmHg |
Indeks bias |
1.569 |
Titik nyala |
117.2°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|