CAS No: 82632-80-2, Chemical Name: 2,3,6,7,10,11-hexabromotriphenylene
the physical and chemical property of 82632-80-2, 2,3,6,7,10,11-hexabromotriphenylene is provided by ChemNet.com
ChemNet > CAS > 82632-80-2 2,3,6,7,10,11-hexabromotriphenylene
82632-80-2 2,3,6,7,10,11-hexabromotriphenylene
Nama produk |
2,3,6,7,10,11-hexabromotriphenylene |
Sinonim |
triphenylene, 2,3,6,7,10,11-hexabromo- |
MF |
C18H6Br6 |
Berat Molekul |
701.6642 |
InChI |
InChI=1/C18H6Br6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6H |
CAS NO |
82632-80-2 |
Struktur Molekul |
|
Kepadatan |
2.429g/cm3 |
Titik didih |
689.788°C at 760 mmHg |
Indeks bias |
1.822 |
Titik nyala |
354.305°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|