ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
Nama produk |
3-chloro-4-fluorophenylhydrazine |
MF |
C6H6ClFN2 |
Berat Molekul |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
CAS NO |
84282-78-0 |
Struktur Molekul |
|
Kepadatan |
1.43g/cm3 |
Titik lebur |
62-63℃ |
Titik didih |
253.1°C at 760 mmHg |
Indeks bias |
1.624 |
Titik nyala |
106.9°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|