ChemNet > CAS > 90721-27-0 1-benzofuran-5-carboxylic acid
90721-27-0 1-benzofuran-5-carboxylic acid
| Nama produk |
1-benzofuran-5-carboxylic acid |
| MF |
C9H6O3 |
| Berat Molekul |
162.1421 |
| InChI |
InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
| CAS NO |
90721-27-0 |
| Struktur Molekul |
|
| Kepadatan |
1.363g/cm3 |
| Titik lebur |
188℃ |
| Titik didih |
325.6°C at 760 mmHg |
| Indeks bias |
1.649 |
| Titik nyala |
150.7°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
